C8H8N2O4 — CID 154928995
4-(2,5-dioxopyrrol-1-yl)-4-oxobutanamide (PubChem CID 154928995) has the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrol-1-yl)-4-oxobutanamide.
| Compound Name | 4-(2,5-dioxopyrrol-1-yl)-4-oxobutanamide |
|---|---|
| PubChem CID | 154928995 |
| Molecular Formula | C8H8N2O4 |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 4-(2,5-dioxopyrrol-1-yl)-4-oxobutanamide |
| SMILES | NC(=O)CCC(=O)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C8H8N2O4/c9-5(11)1-2-6(12)10-7(13)3-4-8(10)14/h3-4H,1-2H2,(H2,9,11) |
| InChIKey | MBIYFOIBPFWZRS-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|