C35H58O4 — CID 174733673
1-[1-(methoxymethyl)cyclohexa-2,5-dien-1-yl]-8-methylnonan-1-one;1-(1-methoxy-2-methylcyclohexa-2,5-dien-1-yl)-7-methyloctan-1-one (PubChem CID 174733673) has the molecular formula C35H58O4 and a molecular weight of 542.85 g/mol. Its IUPAC name is 1-[1-(methoxymethyl)cyclohexa-2,5-dien-1-yl]-8-methylnonan-1-one;1-(1-methoxy-2-methylcyclohexa-2,5-dien-1-yl)-7-methyloctan-1-one.
| Compound Name | 1-[1-(methoxymethyl)cyclohexa-2,5-dien-1-yl]-8-methylnonan-1-one;1-(1-methoxy-2-methylcyclohexa-2,5-dien-1-yl)-7-methyloctan-1-one |
|---|---|
| PubChem CID | 174733673 |
| Molecular Formula | C35H58O4 |
| Molecular Weight | 542.85 g/mol |
| Exact Mass | 542.43 |
| IUPAC Name | 1-[1-(methoxymethyl)cyclohexa-2,5-dien-1-yl]-8-methylnonan-1-one;1-(1-methoxy-2-methylcyclohexa-2,5-dien-1-yl)-7-methyloctan-1-one |
| SMILES | COC1(C(=O)CCCCCC(C)C)C=CCC=C1C.COCC1(C(=O)CCCCCCC(C)C)C=CCC=C1 |
| InChI | InChI=1S/C18H30O2.C17H28O2/c1-16(2)11-7-4-5-8-12-17(19)18(15-20-3)13-9-6-10-14-18;1-14(2)10-6-5-7-12-16(18)17(19-4)13-9-8-11-15(17)3/h9-10,13-14,16H,4-8,11-12,15H2,1-3H3;9,11,13-14H,5-8,10,12H2,1-4H3 |
| InChIKey | VJKGHVHKEMRQJX-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.85 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|