C18H34O2 — CID 67498292
1-[1-(methoxymethyl)-2,5-dimethylcyclopentyl]-7-methyloctan-1-one (PubChem CID 67498292) has the molecular formula C18H34O2 and a molecular weight of 282.47 g/mol. Its IUPAC name is 1-[1-(methoxymethyl)-2,5-dimethylcyclopentyl]-7-methyloctan-1-one.
| Compound Name | 1-[1-(methoxymethyl)-2,5-dimethylcyclopentyl]-7-methyloctan-1-one |
|---|---|
| PubChem CID | 67498292 |
| Molecular Formula | C18H34O2 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.26 |
| IUPAC Name | 1-[1-(methoxymethyl)-2,5-dimethylcyclopentyl]-7-methyloctan-1-one |
| SMILES | COCC1(C(=O)CCCCCC(C)C)C(C)CCC1C |
| InChI | InChI=1S/C18H34O2/c1-14(2)9-7-6-8-10-17(19)18(13-20-5)15(3)11-12-16(18)4/h14-16H,6-13H2,1-5H3 |
| InChIKey | MAGRVLGXCRZDLZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|