About 2-bromonaphthalen-1-ol;methoxymethane
2-bromonaphthalen-1-ol;methoxymethane (PubChem CID 174734204) has the molecular formula C12H13BrO2
and a molecular weight of 269.14 g/mol. Its IUPAC name is 2-bromonaphthalen-1-ol;methoxymethane.
Molecular Properties
| Compound Name | 2-bromonaphthalen-1-ol;methoxymethane |
| PubChem CID | 174734204 |
| Molecular Formula | C12H13BrO2 |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 2-bromonaphthalen-1-ol;methoxymethane |
| SMILES | COC.Oc1c(Br)ccc2ccccc12 |
| InChI | InChI=1S/C10H7BrO.C2H6O/c11-9-6-5-7-3-1-2-4-8(7)10(9)12;1-3-2/h1-6,12H;1-2H3 |
| InChIKey | FSYLLQNPHKOMCQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromonaphthalen-1-ol;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromonaphthalen-1-ol;methoxymethane?
The IUPAC name of 2-bromonaphthalen-1-ol;methoxymethane (CID 174734204) is 2-bromonaphthalen-1-ol;methoxymethane.
What is the SMILES notation for 2-bromonaphthalen-1-ol;methoxymethane?
The canonical SMILES for 2-bromonaphthalen-1-ol;methoxymethane is COC.Oc1c(Br)ccc2ccccc12.
What is the InChIKey of 2-bromonaphthalen-1-ol;methoxymethane?
The InChIKey is FSYLLQNPHKOMCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrO.C2H6O/c11-9-6-5-7-3-1-2-4-8(7)10(9)12;1-3-2/h1-6,12H;1-2H3.
What are the key properties of 2-bromonaphthalen-1-ol;methoxymethane?
2-bromonaphthalen-1-ol;methoxymethane has a molecular weight of 269.14 g/mol, XLogP of 3.57, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromonaphthalen-1-ol;methoxymethane is sourced from PubChem (CID 174734204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).