C22H24N4O2 — CID 174735299
4-aminobenzoic acid;1-benzyl-3-ethyl-2H-benzotriazole (PubChem CID 174735299) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 4-aminobenzoic acid;1-benzyl-3-ethyl-2H-benzotriazole.
| Compound Name | 4-aminobenzoic acid;1-benzyl-3-ethyl-2H-benzotriazole |
|---|---|
| PubChem CID | 174735299 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 4-aminobenzoic acid;1-benzyl-3-ethyl-2H-benzotriazole |
| SMILES | CCN1NN(Cc2ccccc2)c2ccccc21.Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C15H17N3.C7H7NO2/c1-2-17-14-10-6-7-11-15(14)18(16-17)12-13-8-4-3-5-9-13;8-6-3-1-5(2-4-6)7(9)10/h3-11,16H,2,12H2,1H3;1-4H,8H2,(H,9,10) |
| InChIKey | IEDFBCGTRUERFA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|