About calcium;hydroxide;permanganate
calcium;hydroxide;permanganate (PubChem CID 174735434) has the molecular formula HCaMnO5
and a molecular weight of 176.02 g/mol. Its IUPAC name is calcium;hydroxide;permanganate.
Molecular Properties
| Compound Name | calcium;hydroxide;permanganate |
| PubChem CID | 174735434 |
| Molecular Formula | HCaMnO5 |
| Molecular Weight | 176.02 g/mol |
| Exact Mass | 175.88 |
| IUPAC Name | calcium;hydroxide;permanganate |
| SMILES | O=[Mn](=O)(=O)[O-].[Ca+2].[OH-] |
| InChI | InChI=1S/Ca.Mn.H2O.4O/h;;1H2;;;;/q+2;;;;;;-1/p-1 |
| InChIKey | RYBYNFRZHRYYTN-UHFFFAOYSA-M |
| XLogP | -2.11 |
| TPSA | 104.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.02 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze calcium;hydroxide;permanganate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;hydroxide;permanganate?
The IUPAC name of calcium;hydroxide;permanganate (CID 174735434) is calcium;hydroxide;permanganate.
What is the SMILES notation for calcium;hydroxide;permanganate?
The canonical SMILES for calcium;hydroxide;permanganate is O=[Mn](=O)(=O)[O-].[Ca+2].[OH-].
What is the InChIKey of calcium;hydroxide;permanganate?
The InChIKey is RYBYNFRZHRYYTN-UHFFFAOYSA-M. The full InChI is InChI=1S/Ca.Mn.H2O.4O/h;;1H2;;;;/q+2;;;;;;-1/p-1.
What are the key properties of calcium;hydroxide;permanganate?
calcium;hydroxide;permanganate has a molecular weight of 176.02 g/mol, XLogP of -2.11, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;hydroxide;permanganate is sourced from PubChem (CID 174735434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).