About potassium;carbon dioxide;permanganate
potassium;carbon dioxide;permanganate (PubChem CID 174549112) has the molecular formula CKMnO6
and a molecular weight of 202.04 g/mol. Its IUPAC name is potassium;carbon dioxide;permanganate.
Molecular Properties
| Compound Name | potassium;carbon dioxide;permanganate |
| PubChem CID | 174549112 |
| Molecular Formula | CKMnO6 |
| Molecular Weight | 202.04 g/mol |
| Exact Mass | 201.87 |
| IUPAC Name | potassium;carbon dioxide;permanganate |
| SMILES | O=C=O.O=[Mn](=O)(=O)[O-].[K+] |
| InChI | InChI=1S/CO2.K.Mn.4O/c2-1-3;;;;;;/q;+1;;;;;-1 |
| InChIKey | MQWAUORHRABPSU-UHFFFAOYSA-N |
| XLogP | -5.13 |
| TPSA | 108.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.04 |
| LogP ≤ 5 | -5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze potassium;carbon dioxide;permanganate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;carbon dioxide;permanganate?
The IUPAC name of potassium;carbon dioxide;permanganate (CID 174549112) is potassium;carbon dioxide;permanganate.
What is the SMILES notation for potassium;carbon dioxide;permanganate?
The canonical SMILES for potassium;carbon dioxide;permanganate is O=C=O.O=[Mn](=O)(=O)[O-].[K+].
What is the InChIKey of potassium;carbon dioxide;permanganate?
The InChIKey is MQWAUORHRABPSU-UHFFFAOYSA-N. The full InChI is InChI=1S/CO2.K.Mn.4O/c2-1-3;;;;;;/q;+1;;;;;-1.
What are the key properties of potassium;carbon dioxide;permanganate?
potassium;carbon dioxide;permanganate has a molecular weight of 202.04 g/mol, XLogP of -5.13, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;carbon dioxide;permanganate is sourced from PubChem (CID 174549112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).