About potassium;oxalic acid;permanganate
potassium;oxalic acid;permanganate (PubChem CID 87082250) has the molecular formula C2H2KMnO8
and a molecular weight of 248.07 g/mol. Its IUPAC name is potassium;oxalic acid;permanganate.
Molecular Properties
| Compound Name | potassium;oxalic acid;permanganate |
| PubChem CID | 87082250 |
| Molecular Formula | C2H2KMnO8 |
| Molecular Weight | 248.07 g/mol |
| Exact Mass | 247.88 |
| IUPAC Name | potassium;oxalic acid;permanganate |
| SMILES | O=C(O)C(=O)O.O=[Mn](=O)(=O)[O-].[K+] |
| InChI | InChI=1S/C2H2O4.K.Mn.4O/c3-1(4)2(5)6;;;;;;/h(H,3,4)(H,5,6);;;;;;/q;+1;;;;;-1 |
| InChIKey | TUJJYHKDWMMFRM-UHFFFAOYSA-N |
| XLogP | -5.39 |
| TPSA | 148.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.07 |
| LogP ≤ 5 | -5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze potassium;oxalic acid;permanganate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;oxalic acid;permanganate?
The IUPAC name of potassium;oxalic acid;permanganate (CID 87082250) is potassium;oxalic acid;permanganate.
What is the SMILES notation for potassium;oxalic acid;permanganate?
The canonical SMILES for potassium;oxalic acid;permanganate is O=C(O)C(=O)O.O=[Mn](=O)(=O)[O-].[K+].
What is the InChIKey of potassium;oxalic acid;permanganate?
The InChIKey is TUJJYHKDWMMFRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2O4.K.Mn.4O/c3-1(4)2(5)6;;;;;;/h(H,3,4)(H,5,6);;;;;;/q;+1;;;;;-1.
What are the key properties of potassium;oxalic acid;permanganate?
potassium;oxalic acid;permanganate has a molecular weight of 248.07 g/mol, XLogP of -5.39, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;oxalic acid;permanganate is sourced from PubChem (CID 87082250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).