C8H13F3N2O3S — CID 174735656
1,2-dimethylimidazole;ethyl trifluoromethanesulfonate (PubChem CID 174735656) has the molecular formula C8H13F3N2O3S and a molecular weight of 274.26 g/mol. Its IUPAC name is 1,2-dimethylimidazole;ethyl trifluoromethanesulfonate.
| Compound Name | 1,2-dimethylimidazole;ethyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 174735656 |
| Molecular Formula | C8H13F3N2O3S |
| Molecular Weight | 274.26 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 1,2-dimethylimidazole;ethyl trifluoromethanesulfonate |
| SMILES | CCOS(=O)(=O)C(F)(F)F.Cc1nccn1C |
| InChI | InChI=1S/C5H8N2.C3H5F3O3S/c1-5-6-3-4-7(5)2;1-2-9-10(7,8)3(4,5)6/h3-4H,1-2H3;2H2,1H3 |
| InChIKey | STMJDHRCQSVIGE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|