About cyclopentylcyclopentane;dibutoxysilane
cyclopentylcyclopentane;dibutoxysilane (PubChem CID 174737860) has the molecular formula C18H38O2Si
and a molecular weight of 314.59 g/mol. Its IUPAC name is cyclopentylcyclopentane;dibutoxysilane.
Molecular Properties
| Compound Name | cyclopentylcyclopentane;dibutoxysilane |
| PubChem CID | 174737860 |
| Molecular Formula | C18H38O2Si |
| Molecular Weight | 314.59 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | cyclopentylcyclopentane;dibutoxysilane |
| SMILES | C1CCC(C2CCCC2)C1.CCCCO[SiH2]OCCCC |
| InChI | InChI=1S/C10H18.C8H20O2Si/c1-2-6-9(5-1)10-7-3-4-8-10;1-3-5-7-9-11-10-8-6-4-2/h9-10H,1-8H2;3-8,11H2,1-2H3 |
| InChIKey | DBWJXJPZAUBJOK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.59 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclopentylcyclopentane;dibutoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentylcyclopentane;dibutoxysilane?
The IUPAC name of cyclopentylcyclopentane;dibutoxysilane (CID 174737860) is cyclopentylcyclopentane;dibutoxysilane.
What is the SMILES notation for cyclopentylcyclopentane;dibutoxysilane?
The canonical SMILES for cyclopentylcyclopentane;dibutoxysilane is C1CCC(C2CCCC2)C1.CCCCO[SiH2]OCCCC.
What is the InChIKey of cyclopentylcyclopentane;dibutoxysilane?
The InChIKey is DBWJXJPZAUBJOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18.C8H20O2Si/c1-2-6-9(5-1)10-7-3-4-8-10;1-3-5-7-9-11-10-8-6-4-2/h9-10H,1-8H2;3-8,11H2,1-2H3.
What are the key properties of cyclopentylcyclopentane;dibutoxysilane?
cyclopentylcyclopentane;dibutoxysilane has a molecular weight of 314.59 g/mol, XLogP of 4.99, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentylcyclopentane;dibutoxysilane is sourced from PubChem (CID 174737860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).