C28H44O8P2 — CID 174738003
2-butylhex-1-enyl-[2-[2-butylhex-1-enyl(hydroxy)phosphoryl]oxycarbonylbenzoyl]oxyphosphinic acid (PubChem CID 174738003) has the molecular formula C28H44O8P2 and a molecular weight of 570.60 g/mol. Its IUPAC name is 2-butylhex-1-enyl-[2-[2-butylhex-1-enyl(hydroxy)phosphoryl]oxycarbonylbenzoyl]oxyphosphinic acid.
| Compound Name | 2-butylhex-1-enyl-[2-[2-butylhex-1-enyl(hydroxy)phosphoryl]oxycarbonylbenzoyl]oxyphosphinic acid |
|---|---|
| PubChem CID | 174738003 |
| Molecular Formula | C28H44O8P2 |
| Molecular Weight | 570.60 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | 2-butylhex-1-enyl-[2-[2-butylhex-1-enyl(hydroxy)phosphoryl]oxycarbonylbenzoyl]oxyphosphinic acid |
| SMILES | CCCCC(=CP(=O)(O)OC(=O)c1ccccc1C(=O)OP(=O)(O)C=C(CCCC)CCCC)CCCC |
| InChI | InChI=1S/C28H44O8P2/c1-5-9-15-23(16-10-6-2)21-37(31,32)35-27(29)25-19-13-14-20-26(25)28(30)36-38(33,34)22-24(17-11-7-3)18-12-8-4/h13-14,19-22H,5-12,15-18H2,1-4H3,(H,31,32)(H,33,34) |
| InChIKey | DEWFWGYUTKWIKO-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.60 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|