C35H62O5 — CID 174739349
cyclohexane;dioctyl benzene-1,2-dicarboxylate;2-methoxy-2-methylpropane (PubChem CID 174739349) has the molecular formula C35H62O5 and a molecular weight of 562.88 g/mol. Its IUPAC name is cyclohexane;dioctyl benzene-1,2-dicarboxylate;2-methoxy-2-methylpropane.
| Compound Name | cyclohexane;dioctyl benzene-1,2-dicarboxylate;2-methoxy-2-methylpropane |
|---|---|
| PubChem CID | 174739349 |
| Molecular Formula | C35H62O5 |
| Molecular Weight | 562.88 g/mol |
| Exact Mass | 562.46 |
| IUPAC Name | cyclohexane;dioctyl benzene-1,2-dicarboxylate;2-methoxy-2-methylpropane |
| SMILES | C1CCCCC1.CCCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCC.COC(C)(C)C |
| InChI | InChI=1S/C24H38O4.C6H12.C5H12O/c1-3-5-7-9-11-15-19-27-23(25)21-17-13-14-18-22(21)24(26)28-20-16-12-10-8-6-4-2;1-2-4-6-5-3-1;1-5(2,3)6-4/h13-14,17-18H,3-12,15-16,19-20H2,1-2H3;1-6H2;1-4H3 |
| InChIKey | BYTJNUIHOGRSQG-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.88 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|