C2H3Br5 — CID 174741256
1,1,2,2-tetrabromoethane;hydrobromide (PubChem CID 174741256) has the molecular formula C2H3Br5 and a molecular weight of 426.57 g/mol. Its IUPAC name is 1,1,2,2-tetrabromoethane;hydrobromide.
| Compound Name | 1,1,2,2-tetrabromoethane;hydrobromide |
|---|---|
| PubChem CID | 174741256 |
| Molecular Formula | C2H3Br5 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 421.62 |
| IUPAC Name | 1,1,2,2-tetrabromoethane;hydrobromide |
| SMILES | Br.BrC(Br)C(Br)Br |
| InChI | InChI=1S/C2H2Br4.BrH/c3-1(4)2(5)6;/h1-2H;1H |
| InChIKey | XAGFYHNOVDWVQJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|