C15H24N2 — CID 174742759
azane;3-methyl-1-(2-phenylcyclopropyl)piperidine (PubChem CID 174742759) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is azane;3-methyl-1-(2-phenylcyclopropyl)piperidine.
| Compound Name | azane;3-methyl-1-(2-phenylcyclopropyl)piperidine |
|---|---|
| PubChem CID | 174742759 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | azane;3-methyl-1-(2-phenylcyclopropyl)piperidine |
| SMILES | CC1CCCN(C2CC2c2ccccc2)C1.N |
| InChI | InChI=1S/C15H21N.H3N/c1-12-6-5-9-16(11-12)15-10-14(15)13-7-3-2-4-8-13;/h2-4,7-8,12,14-15H,5-6,9-11H2,1H3;1H3 |
| InChIKey | ICWXOTRDSNTQHF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 38.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |