About benzoic acid;(8-hydroxyquinolin-5-yl)iminoazanide;zinc
benzoic acid;(8-hydroxyquinolin-5-yl)iminoazanide;zinc (PubChem CID 174743616) has the molecular formula C16H12N3O3Zn-
and a molecular weight of 359.68 g/mol. Its IUPAC name is benzoic acid;(8-hydroxyquinolin-5-yl)iminoazanide;zinc.
Molecular Properties
| Compound Name | benzoic acid;(8-hydroxyquinolin-5-yl)iminoazanide;zinc |
| PubChem CID | 174743616 |
| Molecular Formula | C16H12N3O3Zn- |
| Molecular Weight | 359.68 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | benzoic acid;(8-hydroxyquinolin-5-yl)iminoazanide;zinc |
| SMILES | O=C(O)c1ccccc1.[N-]=Nc1ccc(O)c2ncccc12.[Zn] |
| InChI | InChI=1S/C9H6N3O.C7H6O2.Zn/c10-12-7-3-4-8(13)9-6(7)2-1-5-11-9;8-7(9)6-4-2-1-3-5-6;/h1-5,13H;1-5H,(H,8,9);/q-1;; |
| InChIKey | XDYSTWIGRJVPJE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 105.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.68 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze benzoic acid;(8-hydroxyquinolin-5-yl)iminoazanide;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;(8-hydroxyquinolin-5-yl)iminoazanide;zinc?
The IUPAC name of benzoic acid;(8-hydroxyquinolin-5-yl)iminoazanide;zinc (CID 174743616) is benzoic acid;(8-hydroxyquinolin-5-yl)iminoazanide;zinc.
What is the SMILES notation for benzoic acid;(8-hydroxyquinolin-5-yl)iminoazanide;zinc?
The canonical SMILES for benzoic acid;(8-hydroxyquinolin-5-yl)iminoazanide;zinc is O=C(O)c1ccccc1.[N-]=Nc1ccc(O)c2ncccc12.[Zn].
What is the InChIKey of benzoic acid;(8-hydroxyquinolin-5-yl)iminoazanide;zinc?
The InChIKey is XDYSTWIGRJVPJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N3O.C7H6O2.Zn/c10-12-7-3-4-8(13)9-6(7)2-1-5-11-9;8-7(9)6-4-2-1-3-5-6;/h1-5,13H;1-5H,(H,8,9);/q-1;;.
What are the key properties of benzoic acid;(8-hydroxyquinolin-5-yl)iminoazanide;zinc?
benzoic acid;(8-hydroxyquinolin-5-yl)iminoazanide;zinc has a molecular weight of 359.68 g/mol, XLogP of 3.98, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;(8-hydroxyquinolin-5-yl)iminoazanide;zinc is sourced from PubChem (CID 174743616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).