C24H27NO5S — CID 174748901
1-nitro-2-phenylbenzene;1-phenylhexane-1-sulfonic acid (PubChem CID 174748901) has the molecular formula C24H27NO5S and a molecular weight of 441.55 g/mol. Its IUPAC name is 1-nitro-2-phenylbenzene;1-phenylhexane-1-sulfonic acid.
| Compound Name | 1-nitro-2-phenylbenzene;1-phenylhexane-1-sulfonic acid |
|---|---|
| PubChem CID | 174748901 |
| Molecular Formula | C24H27NO5S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 1-nitro-2-phenylbenzene;1-phenylhexane-1-sulfonic acid |
| SMILES | CCCCCC(c1ccccc1)S(=O)(=O)O.O=[N+]([O-])c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C12H9NO2.C12H18O3S/c14-13(15)12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-2-3-5-10-12(16(13,14)15)11-8-6-4-7-9-11/h1-9H;4,6-9,12H,2-3,5,10H2,1H3,(H,13,14,15) |
| InChIKey | DREKLDNPHCXPPK-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|