About potassium;benzene;ethenyl sulfate
potassium;benzene;ethenyl sulfate (PubChem CID 174749179) has the molecular formula C8H9KO4S
and a molecular weight of 240.32 g/mol. Its IUPAC name is potassium;benzene;ethenyl sulfate.
Molecular Properties
| Compound Name | potassium;benzene;ethenyl sulfate |
| PubChem CID | 174749179 |
| Molecular Formula | C8H9KO4S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 239.99 |
| IUPAC Name | potassium;benzene;ethenyl sulfate |
| SMILES | C=COS(=O)(=O)[O-].[K+].c1ccccc1 |
| InChI | InChI=1S/C6H6.C2H4O4S.K/c1-2-4-6-5-3-1;1-2-6-7(3,4)5;/h1-6H;2H,1H2,(H,3,4,5);/q;;+1/p-1 |
| InChIKey | OGWXXDNMNGQULX-UHFFFAOYSA-M |
| XLogP | -1.70 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze potassium;benzene;ethenyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;benzene;ethenyl sulfate?
The IUPAC name of potassium;benzene;ethenyl sulfate (CID 174749179) is potassium;benzene;ethenyl sulfate.
What is the SMILES notation for potassium;benzene;ethenyl sulfate?
The canonical SMILES for potassium;benzene;ethenyl sulfate is C=COS(=O)(=O)[O-].[K+].c1ccccc1.
What is the InChIKey of potassium;benzene;ethenyl sulfate?
The InChIKey is OGWXXDNMNGQULX-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H6.C2H4O4S.K/c1-2-4-6-5-3-1;1-2-6-7(3,4)5;/h1-6H;2H,1H2,(H,3,4,5);/q;;+1/p-1.
What are the key properties of potassium;benzene;ethenyl sulfate?
potassium;benzene;ethenyl sulfate has a molecular weight of 240.32 g/mol, XLogP of -1.70, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;benzene;ethenyl sulfate is sourced from PubChem (CID 174749179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).