C22H29F3N6O2 — CID 174749257
1-[(6-amino-2-formylpyrimidin-4-yl)methyl]-N-tert-butylpiperidine-4-carboxamide;2-(trifluoromethyl)pyridine (PubChem CID 174749257) has the molecular formula C22H29F3N6O2 and a molecular weight of 466.51 g/mol. Its IUPAC name is 1-[(6-amino-2-formylpyrimidin-4-yl)methyl]-N-tert-butylpiperidine-4-carboxamide;2-(trifluoromethyl)pyridine.
| Compound Name | 1-[(6-amino-2-formylpyrimidin-4-yl)methyl]-N-tert-butylpiperidine-4-carboxamide;2-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 174749257 |
| Molecular Formula | C22H29F3N6O2 |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | 1-[(6-amino-2-formylpyrimidin-4-yl)methyl]-N-tert-butylpiperidine-4-carboxamide;2-(trifluoromethyl)pyridine |
| SMILES | CC(C)(C)NC(=O)C1CCN(Cc2cc(N)nc(C=O)n2)CC1.FC(F)(F)c1ccccn1 |
| InChI | InChI=1S/C16H25N5O2.C6H4F3N/c1-16(2,3)20-15(23)11-4-6-21(7-5-11)9-12-8-13(17)19-14(10-22)18-12;7-6(8,9)5-3-1-2-4-10-5/h8,10-11H,4-7,9H2,1-3H3,(H,20,23)(H2,17,18,19);1-4H |
| InChIKey | KZJOJTDZPHMPRM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|