C21H25F3N4O2 — CID 175288656
1-[(3-amino-2-formylphenyl)methyl]-N-methylpiperidine-4-carboxamide;2-(trifluoromethyl)pyridine (PubChem CID 175288656) has the molecular formula C21H25F3N4O2 and a molecular weight of 422.45 g/mol. Its IUPAC name is 1-[(3-amino-2-formylphenyl)methyl]-N-methylpiperidine-4-carboxamide;2-(trifluoromethyl)pyridine.
| Compound Name | 1-[(3-amino-2-formylphenyl)methyl]-N-methylpiperidine-4-carboxamide;2-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 175288656 |
| Molecular Formula | C21H25F3N4O2 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 1-[(3-amino-2-formylphenyl)methyl]-N-methylpiperidine-4-carboxamide;2-(trifluoromethyl)pyridine |
| SMILES | CNC(=O)C1CCN(Cc2cccc(N)c2C=O)CC1.FC(F)(F)c1ccccn1 |
| InChI | InChI=1S/C15H21N3O2.C6H4F3N/c1-17-15(20)11-5-7-18(8-6-11)9-12-3-2-4-14(16)13(12)10-19;7-6(8,9)5-3-1-2-4-10-5/h2-4,10-11H,5-9,16H2,1H3,(H,17,20);1-4H |
| InChIKey | CCJODOVDTYPIPJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|