About (diacetyloxyamino) acetate;iron
(diacetyloxyamino) acetate;iron (PubChem CID 174751012) has the molecular formula C6H9FeNO6
and a molecular weight of 246.98 g/mol. Its IUPAC name is (diacetyloxyamino) acetate;iron.
Molecular Properties
| Compound Name | (diacetyloxyamino) acetate;iron |
| PubChem CID | 174751012 |
| Molecular Formula | C6H9FeNO6 |
| Molecular Weight | 246.98 g/mol |
| Exact Mass | 246.98 |
| IUPAC Name | (diacetyloxyamino) acetate;iron |
| SMILES | CC(=O)ON(OC(C)=O)OC(C)=O.[Fe] |
| InChI | InChI=1S/C6H9NO6.Fe/c1-4(8)11-7(12-5(2)9)13-6(3)10;/h1-3H3; |
| InChIKey | CGQGHYMTVJBSLR-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.98 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (diacetyloxyamino) acetate;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (diacetyloxyamino) acetate;iron?
The IUPAC name of (diacetyloxyamino) acetate;iron (CID 174751012) is (diacetyloxyamino) acetate;iron.
What is the SMILES notation for (diacetyloxyamino) acetate;iron?
The canonical SMILES for (diacetyloxyamino) acetate;iron is CC(=O)ON(OC(C)=O)OC(C)=O.[Fe].
What is the InChIKey of (diacetyloxyamino) acetate;iron?
The InChIKey is CGQGHYMTVJBSLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO6.Fe/c1-4(8)11-7(12-5(2)9)13-6(3)10;/h1-3H3;.
What are the key properties of (diacetyloxyamino) acetate;iron?
(diacetyloxyamino) acetate;iron has a molecular weight of 246.98 g/mol, XLogP of -0.28, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (diacetyloxyamino) acetate;iron is sourced from PubChem (CID 174751012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).