About [acetyloxy-[2-(diacetyloxyamino)ethyl]amino] acetate;azane
[acetyloxy-[2-(diacetyloxyamino)ethyl]amino] acetate;azane (PubChem CID 173013590) has the molecular formula C10H28N6O8
and a molecular weight of 360.37 g/mol. Its IUPAC name is [acetyloxy-[2-(diacetyloxyamino)ethyl]amino] acetate;azane.
Molecular Properties
| Compound Name | [acetyloxy-[2-(diacetyloxyamino)ethyl]amino] acetate;azane |
| PubChem CID | 173013590 |
| Molecular Formula | C10H28N6O8 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | [acetyloxy-[2-(diacetyloxyamino)ethyl]amino] acetate;azane |
| SMILES | CC(=O)ON(CCN(OC(C)=O)OC(C)=O)OC(C)=O.N.N.N.N |
| InChI | InChI=1S/C10H16N2O8.4H3N/c1-7(13)17-11(18-8(2)14)5-6-12(19-9(3)15)20-10(4)16;;;;/h5-6H2,1-4H3;4*1H3 |
| InChIKey | FDBFZTHMAWZTRV-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 251.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [acetyloxy-[2-(diacetyloxyamino)ethyl]amino] acetate;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [acetyloxy-[2-(diacetyloxyamino)ethyl]amino] acetate;azane?
The IUPAC name of [acetyloxy-[2-(diacetyloxyamino)ethyl]amino] acetate;azane (CID 173013590) is [acetyloxy-[2-(diacetyloxyamino)ethyl]amino] acetate;azane.
What is the SMILES notation for [acetyloxy-[2-(diacetyloxyamino)ethyl]amino] acetate;azane?
The canonical SMILES for [acetyloxy-[2-(diacetyloxyamino)ethyl]amino] acetate;azane is CC(=O)ON(CCN(OC(C)=O)OC(C)=O)OC(C)=O.N.N.N.N.
What is the InChIKey of [acetyloxy-[2-(diacetyloxyamino)ethyl]amino] acetate;azane?
The InChIKey is FDBFZTHMAWZTRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O8.4H3N/c1-7(13)17-11(18-8(2)14)5-6-12(19-9(3)15)20-10(4)16;;;;/h5-6H2,1-4H3;4*1H3.
What are the key properties of [acetyloxy-[2-(diacetyloxyamino)ethyl]amino] acetate;azane?
[acetyloxy-[2-(diacetyloxyamino)ethyl]amino] acetate;azane has a molecular weight of 360.37 g/mol, XLogP of 0.15, 7 rotatable bonds, 4 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for [acetyloxy-[2-(diacetyloxyamino)ethyl]amino] acetate;azane is sourced from PubChem (CID 173013590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).