About [methyl(tridecyl)amino] acetate
[methyl(tridecyl)amino] acetate (PubChem CID 87650867) has the molecular formula C16H33NO2
and a molecular weight of 271.44 g/mol. Its IUPAC name is [methyl(tridecyl)amino] acetate.
Molecular Properties
| Compound Name | [methyl(tridecyl)amino] acetate |
| PubChem CID | 87650867 |
| Molecular Formula | C16H33NO2 |
| Molecular Weight | 271.44 g/mol |
| Exact Mass | 271.25 |
| IUPAC Name | [methyl(tridecyl)amino] acetate |
| SMILES | CCCCCCCCCCCCCN(C)OC(C)=O |
| InChI | InChI=1S/C16H33NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-17(3)19-16(2)18/h4-15H2,1-3H3 |
| InChIKey | CEEYADXHYYFPDR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [methyl(tridecyl)amino] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [methyl(tridecyl)amino] acetate?
The IUPAC name of [methyl(tridecyl)amino] acetate (CID 87650867) is [methyl(tridecyl)amino] acetate.
What is the SMILES notation for [methyl(tridecyl)amino] acetate?
The canonical SMILES for [methyl(tridecyl)amino] acetate is CCCCCCCCCCCCCN(C)OC(C)=O.
What is the InChIKey of [methyl(tridecyl)amino] acetate?
The InChIKey is CEEYADXHYYFPDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-17(3)19-16(2)18/h4-15H2,1-3H3.
What are the key properties of [methyl(tridecyl)amino] acetate?
[methyl(tridecyl)amino] acetate has a molecular weight of 271.44 g/mol, XLogP of 4.71, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [methyl(tridecyl)amino] acetate is sourced from PubChem (CID 87650867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).