About [dodecyl-(N'-methylcarbamimidoyl)amino] acetate
[dodecyl-(N'-methylcarbamimidoyl)amino] acetate (PubChem CID 57015324) has the molecular formula C16H33N3O2
and a molecular weight of 299.46 g/mol. Its IUPAC name is [dodecyl-(N'-methylcarbamimidoyl)amino] acetate.
Molecular Properties
| Compound Name | [dodecyl-(N'-methylcarbamimidoyl)amino] acetate |
| PubChem CID | 57015324 |
| Molecular Formula | C16H33N3O2 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.26 |
| IUPAC Name | [dodecyl-(N'-methylcarbamimidoyl)amino] acetate |
| SMILES | CCCCCCCCCCCCN(OC(C)=O)/C(N)=N/C |
| InChI | InChI=1S/C16H33N3O2/c1-4-5-6-7-8-9-10-11-12-13-14-19(16(17)18-3)21-15(2)20/h4-14H2,1-3H3,(H2,17,18) |
| InChIKey | JNMGBZMJKTWGAS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [dodecyl-(N'-methylcarbamimidoyl)amino] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dodecyl-(N'-methylcarbamimidoyl)amino] acetate?
The IUPAC name of [dodecyl-(N'-methylcarbamimidoyl)amino] acetate (CID 57015324) is [dodecyl-(N'-methylcarbamimidoyl)amino] acetate.
What is the SMILES notation for [dodecyl-(N'-methylcarbamimidoyl)amino] acetate?
The canonical SMILES for [dodecyl-(N'-methylcarbamimidoyl)amino] acetate is CCCCCCCCCCCCN(OC(C)=O)/C(N)=N/C.
What is the InChIKey of [dodecyl-(N'-methylcarbamimidoyl)amino] acetate?
The InChIKey is JNMGBZMJKTWGAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33N3O2/c1-4-5-6-7-8-9-10-11-12-13-14-19(16(17)18-3)21-15(2)20/h4-14H2,1-3H3,(H2,17,18).
What are the key properties of [dodecyl-(N'-methylcarbamimidoyl)amino] acetate?
[dodecyl-(N'-methylcarbamimidoyl)amino] acetate has a molecular weight of 299.46 g/mol, XLogP of 3.63, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [dodecyl-(N'-methylcarbamimidoyl)amino] acetate is sourced from PubChem (CID 57015324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).