C12H23N5O2 — CID 175203144
[[N-(diaminomethylidene)carbamimidoyl]-hexylamino] 2-methylprop-2-enoate (PubChem CID 175203144) has the molecular formula C12H23N5O2 and a molecular weight of 269.35 g/mol. Its IUPAC name is [[N-(diaminomethylidene)carbamimidoyl]-hexylamino] 2-methylprop-2-enoate.
| Compound Name | [[N-(diaminomethylidene)carbamimidoyl]-hexylamino] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 175203144 |
| Molecular Formula | C12H23N5O2 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | [[N-(diaminomethylidene)carbamimidoyl]-hexylamino] 2-methylprop-2-enoate |
| SMILES | [H]/N=C(\N=C(N)N)N(CCCCCC)OC(=O)C(=C)C |
| InChI | InChI=1S/C12H23N5O2/c1-4-5-6-7-8-17(12(15)16-11(13)14)19-10(18)9(2)3/h2,4-8H2,1,3H3,(H5,13,14,15,16) |
| InChIKey | VMVMBCNVMLNDHP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|