C26H30O2 — CID 174752402
1,2-bis[(2-methylpropan-2-yl)oxy]-4-(2-phenylphenyl)benzene (PubChem CID 174752402) has the molecular formula C26H30O2 and a molecular weight of 374.52 g/mol. Its IUPAC name is 1,2-bis[(2-methylpropan-2-yl)oxy]-4-(2-phenylphenyl)benzene.
| Compound Name | 1,2-bis[(2-methylpropan-2-yl)oxy]-4-(2-phenylphenyl)benzene |
|---|---|
| PubChem CID | 174752402 |
| Molecular Formula | C26H30O2 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 1,2-bis[(2-methylpropan-2-yl)oxy]-4-(2-phenylphenyl)benzene |
| SMILES | CC(C)(C)Oc1ccc(-c2ccccc2-c2ccccc2)cc1OC(C)(C)C |
| InChI | InChI=1S/C26H30O2/c1-25(2,3)27-23-17-16-20(18-24(23)28-26(4,5)6)22-15-11-10-14-21(22)19-12-8-7-9-13-19/h7-18H,1-6H3 |
| InChIKey | BLSPHXRFMRNMIE-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |