C12H17N3O — CID 174753135
4-(methylamino)-5-(1-methylpyrrolidin-2-yl)pyridine-2-carbaldehyde (PubChem CID 174753135) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is 4-(methylamino)-5-(1-methylpyrrolidin-2-yl)pyridine-2-carbaldehyde.
| Compound Name | 4-(methylamino)-5-(1-methylpyrrolidin-2-yl)pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 174753135 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 4-(methylamino)-5-(1-methylpyrrolidin-2-yl)pyridine-2-carbaldehyde |
| SMILES | CNc1cc(C=O)ncc1C1CCCN1C |
| InChI | InChI=1S/C12H17N3O/c1-13-11-6-9(8-16)14-7-10(11)12-4-3-5-15(12)2/h6-8,12H,3-5H2,1-2H3,(H,13,14) |
| InChIKey | UCIYOEVXCJPJAR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|