C12H18ClN3O — CID 174930186
2-chloro-N-methyl-5-(1-methylpyrrolidin-2-yl)pyridin-4-amine;formaldehyde (PubChem CID 174930186) has the molecular formula C12H18ClN3O and a molecular weight of 255.75 g/mol. Its IUPAC name is 2-chloro-N-methyl-5-(1-methylpyrrolidin-2-yl)pyridin-4-amine;formaldehyde.
| Compound Name | 2-chloro-N-methyl-5-(1-methylpyrrolidin-2-yl)pyridin-4-amine;formaldehyde |
|---|---|
| PubChem CID | 174930186 |
| Molecular Formula | C12H18ClN3O |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 2-chloro-N-methyl-5-(1-methylpyrrolidin-2-yl)pyridin-4-amine;formaldehyde |
| SMILES | C=O.CNc1cc(Cl)ncc1C1CCCN1C |
| InChI | InChI=1S/C11H16ClN3.CH2O/c1-13-9-6-11(12)14-7-8(9)10-4-3-5-15(10)2;1-2/h6-7,10H,3-5H2,1-2H3,(H,13,14);1H2 |
| InChIKey | BVXHNFGMIJMFHA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|