C21H22O — CID 174755759
7-(2-methoxyethyl)-1,2,11,12-tetrahydrochrysene (PubChem CID 174755759) has the molecular formula C21H22O and a molecular weight of 290.41 g/mol. Its IUPAC name is 7-(2-methoxyethyl)-1,2,11,12-tetrahydrochrysene.
| Compound Name | 7-(2-methoxyethyl)-1,2,11,12-tetrahydrochrysene |
|---|---|
| PubChem CID | 174755759 |
| Molecular Formula | C21H22O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 7-(2-methoxyethyl)-1,2,11,12-tetrahydrochrysene |
| SMILES | COCCc1cccc2c3c(ccc12)C1=C(CCC=C1)CC3 |
| InChI | InChI=1S/C21H22O/c1-22-14-13-16-6-4-8-19-18(16)11-12-20-17-7-3-2-5-15(17)9-10-21(19)20/h3-4,6-8,11-12H,2,5,9-10,13-14H2,1H3 |
| InChIKey | WEBWXPISSUTAFM-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |