C12H10F3N3OS — CID 174756092
2-(4-ethenyl-1,3-thiazol-2-yl)-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetaldehyde (PubChem CID 174756092) has the molecular formula C12H10F3N3OS and a molecular weight of 301.29 g/mol. Its IUPAC name is 2-(4-ethenyl-1,3-thiazol-2-yl)-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetaldehyde.
| Compound Name | 2-(4-ethenyl-1,3-thiazol-2-yl)-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 174756092 |
| Molecular Formula | C12H10F3N3OS |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 2-(4-ethenyl-1,3-thiazol-2-yl)-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetaldehyde |
| SMILES | C=Cc1csc(C(C=O)n2nc(C(F)(F)F)cc2C)n1 |
| InChI | InChI=1S/C12H10F3N3OS/c1-3-8-6-20-11(16-8)9(5-19)18-7(2)4-10(17-18)12(13,14)15/h3-6,9H,1H2,2H3 |
| InChIKey | IZJBWIOGDVJDPE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|