C14H23F3N4O — CID 19534882
N-[2-(diethylamino)ethyl]-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propanamide (PubChem CID 19534882) has the molecular formula C14H23F3N4O and a molecular weight of 320.36 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propanamide.
| Compound Name | N-[2-(diethylamino)ethyl]-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propanamide |
|---|---|
| PubChem CID | 19534882 |
| Molecular Formula | C14H23F3N4O |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propanamide |
| SMILES | CCN(CC)CCNC(=O)C(C)n1nc(C(F)(F)F)cc1C |
| InChI | InChI=1S/C14H23F3N4O/c1-5-20(6-2)8-7-18-13(22)11(4)21-10(3)9-12(19-21)14(15,16)17/h9,11H,5-8H2,1-4H3,(H,18,22) |
| InChIKey | AXMROGROVIQWJE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |