C15H22F3N3O — CID 51390590
(2S)-N-(4-methylcyclohexyl)-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propanamide (PubChem CID 51390590) has the molecular formula C15H22F3N3O and a molecular weight of 317.36 g/mol. Its IUPAC name is (2S)-N-(4-methylcyclohexyl)-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propanamide.
| Compound Name | (2S)-N-(4-methylcyclohexyl)-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propanamide |
|---|---|
| PubChem CID | 51390590 |
| Molecular Formula | C15H22F3N3O |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | (2S)-N-(4-methylcyclohexyl)-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propanamide |
| SMILES | Cc1cc(C(F)(F)F)nn1[C@@H](C)C(=O)NC1CCC(C)CC1 |
| InChI | InChI=1S/C15H22F3N3O/c1-9-4-6-12(7-5-9)19-14(22)11(3)21-10(2)8-13(20-21)15(16,17)18/h8-9,11-12H,4-7H2,1-3H3,(H,19,22)/t9?,11-,12?/m0/s1 |
| InChIKey | UJOPVHUKUADCAJ-ZYXZCXLHSA-N |
| XLogP | 3.47 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |