About lithium;ethoxysulfonyl methanesulfonate;hydride
lithium;ethoxysulfonyl methanesulfonate;hydride (PubChem CID 174759292) has the molecular formula C3H9LiO6S2
and a molecular weight of 212.17 g/mol. Its IUPAC name is lithium;ethoxysulfonyl methanesulfonate;hydride.
Molecular Properties
| Compound Name | lithium;ethoxysulfonyl methanesulfonate;hydride |
| PubChem CID | 174759292 |
| Molecular Formula | C3H9LiO6S2 |
| Molecular Weight | 212.17 g/mol |
| Exact Mass | 212.00 |
| IUPAC Name | lithium;ethoxysulfonyl methanesulfonate;hydride |
| SMILES | CCOS(=O)(=O)OS(C)(=O)=O.[H-].[Li+] |
| InChI | InChI=1S/C3H8O6S2.Li.H/c1-3-8-11(6,7)9-10(2,4)5;;/h3H2,1-2H3;;/q;+1;-1 |
| InChIKey | SRXCBKCQYUCDCF-UHFFFAOYSA-N |
| XLogP | -3.64 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.17 |
| LogP ≤ 5 | -3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze lithium;ethoxysulfonyl methanesulfonate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;ethoxysulfonyl methanesulfonate;hydride?
The IUPAC name of lithium;ethoxysulfonyl methanesulfonate;hydride (CID 174759292) is lithium;ethoxysulfonyl methanesulfonate;hydride.
What is the SMILES notation for lithium;ethoxysulfonyl methanesulfonate;hydride?
The canonical SMILES for lithium;ethoxysulfonyl methanesulfonate;hydride is CCOS(=O)(=O)OS(C)(=O)=O.[H-].[Li+].
What is the InChIKey of lithium;ethoxysulfonyl methanesulfonate;hydride?
The InChIKey is SRXCBKCQYUCDCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O6S2.Li.H/c1-3-8-11(6,7)9-10(2,4)5;;/h3H2,1-2H3;;/q;+1;-1.
What are the key properties of lithium;ethoxysulfonyl methanesulfonate;hydride?
lithium;ethoxysulfonyl methanesulfonate;hydride has a molecular weight of 212.17 g/mol, XLogP of -3.64, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;ethoxysulfonyl methanesulfonate;hydride is sourced from PubChem (CID 174759292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).