About lithium;ethyl trifluoromethoxy sulfate;hydride
lithium;ethyl trifluoromethoxy sulfate;hydride (PubChem CID 174759625) has the molecular formula C3H6F3LiO5S
and a molecular weight of 218.08 g/mol. Its IUPAC name is lithium;ethyl trifluoromethoxy sulfate;hydride.
Molecular Properties
| Compound Name | lithium;ethyl trifluoromethoxy sulfate;hydride |
| PubChem CID | 174759625 |
| Molecular Formula | C3H6F3LiO5S |
| Molecular Weight | 218.08 g/mol |
| Exact Mass | 218.00 |
| IUPAC Name | lithium;ethyl trifluoromethoxy sulfate;hydride |
| SMILES | CCOS(=O)(=O)OOC(F)(F)F.[H-].[Li+] |
| InChI | InChI=1S/C3H5F3O5S.Li.H/c1-2-9-12(7,8)11-10-3(4,5)6;;/h2H2,1H3;;/q;+1;-1 |
| InChIKey | VIZTXQQKHNRNKV-UHFFFAOYSA-N |
| XLogP | -2.15 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.08 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze lithium;ethyl trifluoromethoxy sulfate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;ethyl trifluoromethoxy sulfate;hydride?
The IUPAC name of lithium;ethyl trifluoromethoxy sulfate;hydride (CID 174759625) is lithium;ethyl trifluoromethoxy sulfate;hydride.
What is the SMILES notation for lithium;ethyl trifluoromethoxy sulfate;hydride?
The canonical SMILES for lithium;ethyl trifluoromethoxy sulfate;hydride is CCOS(=O)(=O)OOC(F)(F)F.[H-].[Li+].
What is the InChIKey of lithium;ethyl trifluoromethoxy sulfate;hydride?
The InChIKey is VIZTXQQKHNRNKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5F3O5S.Li.H/c1-2-9-12(7,8)11-10-3(4,5)6;;/h2H2,1H3;;/q;+1;-1.
What are the key properties of lithium;ethyl trifluoromethoxy sulfate;hydride?
lithium;ethyl trifluoromethoxy sulfate;hydride has a molecular weight of 218.08 g/mol, XLogP of -2.15, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;ethyl trifluoromethoxy sulfate;hydride is sourced from PubChem (CID 174759625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).