About pyrrolidin-3-yl N-butyl-N-(2-fluoroethyl)carbamate
pyrrolidin-3-yl N-butyl-N-(2-fluoroethyl)carbamate (PubChem CID 174759358) has the molecular formula C11H21FN2O2
and a molecular weight of 232.30 g/mol. Its IUPAC name is pyrrolidin-3-yl N-butyl-N-(2-fluoroethyl)carbamate.
Molecular Properties
| Compound Name | pyrrolidin-3-yl N-butyl-N-(2-fluoroethyl)carbamate |
| PubChem CID | 174759358 |
| Molecular Formula | C11H21FN2O2 |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | pyrrolidin-3-yl N-butyl-N-(2-fluoroethyl)carbamate |
| SMILES | CCCCN(CCF)C(=O)OC1CCNC1 |
| InChI | InChI=1S/C11H21FN2O2/c1-2-3-7-14(8-5-12)11(15)16-10-4-6-13-9-10/h10,13H,2-9H2,1H3 |
| InChIKey | RYZQWVZMXGTYPL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrrolidin-3-yl N-butyl-N-(2-fluoroethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidin-3-yl N-butyl-N-(2-fluoroethyl)carbamate?
The IUPAC name of pyrrolidin-3-yl N-butyl-N-(2-fluoroethyl)carbamate (CID 174759358) is pyrrolidin-3-yl N-butyl-N-(2-fluoroethyl)carbamate.
What is the SMILES notation for pyrrolidin-3-yl N-butyl-N-(2-fluoroethyl)carbamate?
The canonical SMILES for pyrrolidin-3-yl N-butyl-N-(2-fluoroethyl)carbamate is CCCCN(CCF)C(=O)OC1CCNC1.
What is the InChIKey of pyrrolidin-3-yl N-butyl-N-(2-fluoroethyl)carbamate?
The InChIKey is RYZQWVZMXGTYPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21FN2O2/c1-2-3-7-14(8-5-12)11(15)16-10-4-6-13-9-10/h10,13H,2-9H2,1H3.
What are the key properties of pyrrolidin-3-yl N-butyl-N-(2-fluoroethyl)carbamate?
pyrrolidin-3-yl N-butyl-N-(2-fluoroethyl)carbamate has a molecular weight of 232.30 g/mol, XLogP of 1.56, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidin-3-yl N-butyl-N-(2-fluoroethyl)carbamate is sourced from PubChem (CID 174759358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).