C18H14F3N3O3S — CID 17476450
N-quinolin-5-yl-3-(2,2,2-trifluoroethylsulfamoyl)benzamide (PubChem CID 17476450) has the molecular formula C18H14F3N3O3S and a molecular weight of 409.39 g/mol. Its IUPAC name is N-quinolin-5-yl-3-(2,2,2-trifluoroethylsulfamoyl)benzamide.
| Compound Name | N-quinolin-5-yl-3-(2,2,2-trifluoroethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 17476450 |
| Molecular Formula | C18H14F3N3O3S |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | N-quinolin-5-yl-3-(2,2,2-trifluoroethylsulfamoyl)benzamide |
| SMILES | O=C(Nc1cccc2ncccc12)c1cccc(S(=O)(=O)NCC(F)(F)F)c1 |
| InChI | InChI=1S/C18H14F3N3O3S/c19-18(20,21)11-23-28(26,27)13-5-1-4-12(10-13)17(25)24-16-8-2-7-15-14(16)6-3-9-22-15/h1-10,23H,11H2,(H,24,25) |
| InChIKey | SIHGJAKDZDVVJT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |