About 2-ethynylbenzaldehyde;toluene
2-ethynylbenzaldehyde;toluene (PubChem CID 174766357) has the molecular formula C16H14O
and a molecular weight of 222.29 g/mol. Its IUPAC name is 2-ethynylbenzaldehyde;toluene.
Molecular Properties
| Compound Name | 2-ethynylbenzaldehyde;toluene |
| PubChem CID | 174766357 |
| Molecular Formula | C16H14O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 2-ethynylbenzaldehyde;toluene |
| SMILES | C#Cc1ccccc1C=O.Cc1ccccc1 |
| InChI | InChI=1S/C9H6O.C7H8/c1-2-8-5-3-4-6-9(8)7-10;1-7-5-3-2-4-6-7/h1,3-7H;2-6H,1H3 |
| InChIKey | DAKIVXDCZCUQRI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethynylbenzaldehyde;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethynylbenzaldehyde;toluene?
The IUPAC name of 2-ethynylbenzaldehyde;toluene (CID 174766357) is 2-ethynylbenzaldehyde;toluene.
What is the SMILES notation for 2-ethynylbenzaldehyde;toluene?
The canonical SMILES for 2-ethynylbenzaldehyde;toluene is C#Cc1ccccc1C=O.Cc1ccccc1.
What is the InChIKey of 2-ethynylbenzaldehyde;toluene?
The InChIKey is DAKIVXDCZCUQRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O.C7H8/c1-2-8-5-3-4-6-9(8)7-10;1-7-5-3-2-4-6-7/h1,3-7H;2-6H,1H3.
What are the key properties of 2-ethynylbenzaldehyde;toluene?
2-ethynylbenzaldehyde;toluene has a molecular weight of 222.29 g/mol, XLogP of 3.48, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethynylbenzaldehyde;toluene is sourced from PubChem (CID 174766357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).