About [(E)-2-(2-chlorophenyl)-2-phenylethenyl] dimethyl phosphate
[(E)-2-(2-chlorophenyl)-2-phenylethenyl] dimethyl phosphate (PubChem CID 174766716) has the molecular formula C16H16ClO4P
and a molecular weight of 338.73 g/mol. Its IUPAC name is [(E)-2-(2-chlorophenyl)-2-phenylethenyl] dimethyl phosphate.
Molecular Properties
| Compound Name | [(E)-2-(2-chlorophenyl)-2-phenylethenyl] dimethyl phosphate |
| PubChem CID | 174766716 |
| Molecular Formula | C16H16ClO4P |
| Molecular Weight | 338.73 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | [(E)-2-(2-chlorophenyl)-2-phenylethenyl] dimethyl phosphate |
| SMILES | COP(=O)(OC)O/C=C(\c1ccccc1)c1ccccc1Cl |
| InChI | InChI=1S/C16H16ClO4P/c1-19-22(18,20-2)21-12-15(13-8-4-3-5-9-13)14-10-6-7-11-16(14)17/h3-12H,1-2H3/b15-12+ |
| InChIKey | QXYWWBWJRSQWNV-NTCAYCPXSA-N |
| XLogP | 5.15 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.73 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(E)-2-(2-chlorophenyl)-2-phenylethenyl] dimethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-2-(2-chlorophenyl)-2-phenylethenyl] dimethyl phosphate?
The IUPAC name of [(E)-2-(2-chlorophenyl)-2-phenylethenyl] dimethyl phosphate (CID 174766716) is [(E)-2-(2-chlorophenyl)-2-phenylethenyl] dimethyl phosphate.
What is the SMILES notation for [(E)-2-(2-chlorophenyl)-2-phenylethenyl] dimethyl phosphate?
The canonical SMILES for [(E)-2-(2-chlorophenyl)-2-phenylethenyl] dimethyl phosphate is COP(=O)(OC)O/C=C(\c1ccccc1)c1ccccc1Cl.
What is the InChIKey of [(E)-2-(2-chlorophenyl)-2-phenylethenyl] dimethyl phosphate?
The InChIKey is QXYWWBWJRSQWNV-NTCAYCPXSA-N. The full InChI is InChI=1S/C16H16ClO4P/c1-19-22(18,20-2)21-12-15(13-8-4-3-5-9-13)14-10-6-7-11-16(14)17/h3-12H,1-2H3/b15-12+.
What are the key properties of [(E)-2-(2-chlorophenyl)-2-phenylethenyl] dimethyl phosphate?
[(E)-2-(2-chlorophenyl)-2-phenylethenyl] dimethyl phosphate has a molecular weight of 338.73 g/mol, XLogP of 5.15, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-2-(2-chlorophenyl)-2-phenylethenyl] dimethyl phosphate is sourced from PubChem (CID 174766716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).