About (1-butylindol-3-yl) propanoate
(1-butylindol-3-yl) propanoate (PubChem CID 174769322) has the molecular formula C15H19NO2
and a molecular weight of 245.32 g/mol. Its IUPAC name is (1-butylindol-3-yl) propanoate.
Molecular Properties
| Compound Name | (1-butylindol-3-yl) propanoate |
| PubChem CID | 174769322 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | (1-butylindol-3-yl) propanoate |
| SMILES | CCCCn1cc(OC(=O)CC)c2ccccc21 |
| InChI | InChI=1S/C15H19NO2/c1-3-5-10-16-11-14(18-15(17)4-2)12-8-6-7-9-13(12)16/h6-9,11H,3-5,10H2,1-2H3 |
| InChIKey | RMMNPYUWNIRAJN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-butylindol-3-yl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-butylindol-3-yl) propanoate?
The IUPAC name of (1-butylindol-3-yl) propanoate (CID 174769322) is (1-butylindol-3-yl) propanoate.
What is the SMILES notation for (1-butylindol-3-yl) propanoate?
The canonical SMILES for (1-butylindol-3-yl) propanoate is CCCCn1cc(OC(=O)CC)c2ccccc21.
What is the InChIKey of (1-butylindol-3-yl) propanoate?
The InChIKey is RMMNPYUWNIRAJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO2/c1-3-5-10-16-11-14(18-15(17)4-2)12-8-6-7-9-13(12)16/h6-9,11H,3-5,10H2,1-2H3.
What are the key properties of (1-butylindol-3-yl) propanoate?
(1-butylindol-3-yl) propanoate has a molecular weight of 245.32 g/mol, XLogP of 3.76, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-butylindol-3-yl) propanoate is sourced from PubChem (CID 174769322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).