C30H32N2O4 — CID 174769768
2-benzoyl-2-(dimethylamino)-3-(morpholin-4-ylmethyl)-1,4-diphenylbutane-1,4-dione (PubChem CID 174769768) has the molecular formula C30H32N2O4 and a molecular weight of 484.60 g/mol. Its IUPAC name is 2-benzoyl-2-(dimethylamino)-3-(morpholin-4-ylmethyl)-1,4-diphenylbutane-1,4-dione.
| Compound Name | 2-benzoyl-2-(dimethylamino)-3-(morpholin-4-ylmethyl)-1,4-diphenylbutane-1,4-dione |
|---|---|
| PubChem CID | 174769768 |
| Molecular Formula | C30H32N2O4 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | 2-benzoyl-2-(dimethylamino)-3-(morpholin-4-ylmethyl)-1,4-diphenylbutane-1,4-dione |
| SMILES | CN(C)C(C(=O)c1ccccc1)(C(=O)c1ccccc1)C(CN1CCOCC1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C30H32N2O4/c1-31(2)30(28(34)24-14-8-4-9-15-24,29(35)25-16-10-5-11-17-25)26(22-32-18-20-36-21-19-32)27(33)23-12-6-3-7-13-23/h3-17,26H,18-22H2,1-2H3 |
| InChIKey | MDILIKAQYLCVLF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|