C12H17O4S- — CID 174770101
4-[3-(hydroxymethyl)-5-methylphenoxy]butane-2-sulfinate (PubChem CID 174770101) has the molecular formula C12H17O4S- and a molecular weight of 257.33 g/mol. Its IUPAC name is 4-[3-(hydroxymethyl)-5-methylphenoxy]butane-2-sulfinate.
| Compound Name | 4-[3-(hydroxymethyl)-5-methylphenoxy]butane-2-sulfinate |
|---|---|
| PubChem CID | 174770101 |
| Molecular Formula | C12H17O4S- |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 4-[3-(hydroxymethyl)-5-methylphenoxy]butane-2-sulfinate |
| SMILES | Cc1cc(CO)cc(OCCC(C)S(=O)[O-])c1 |
| InChI | InChI=1S/C12H18O4S/c1-9-5-11(8-13)7-12(6-9)16-4-3-10(2)17(14)15/h5-7,10,13H,3-4,8H2,1-2H3,(H,14,15)/p-1 |
| InChIKey | BTDZDSCRMNHVMY-UHFFFAOYSA-M |
| XLogP | 1.52 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|