C19H40O12S4 — CID 174772675
4-ethyl-7-[(4-ethyl-5-sulfoheptyl)sulfonyloxymethoxysulfonyl]heptane-3-sulfonic acid (PubChem CID 174772675) has the molecular formula C19H40O12S4 and a molecular weight of 588.79 g/mol. Its IUPAC name is 4-ethyl-7-[(4-ethyl-5-sulfoheptyl)sulfonyloxymethoxysulfonyl]heptane-3-sulfonic acid.
| Compound Name | 4-ethyl-7-[(4-ethyl-5-sulfoheptyl)sulfonyloxymethoxysulfonyl]heptane-3-sulfonic acid |
|---|---|
| PubChem CID | 174772675 |
| Molecular Formula | C19H40O12S4 |
| Molecular Weight | 588.79 g/mol |
| Exact Mass | 588.14 |
| IUPAC Name | 4-ethyl-7-[(4-ethyl-5-sulfoheptyl)sulfonyloxymethoxysulfonyl]heptane-3-sulfonic acid |
| SMILES | CCC(CCCS(=O)(=O)OCOS(=O)(=O)CCCC(CC)C(CC)S(=O)(=O)O)C(CC)S(=O)(=O)O |
| InChI | InChI=1S/C19H40O12S4/c1-5-16(18(7-3)34(24,25)26)11-9-13-32(20,21)30-15-31-33(22,23)14-10-12-17(6-2)19(8-4)35(27,28)29/h16-19H,5-15H2,1-4H3,(H,24,25,26)(H,27,28,29) |
| InChIKey | AKRKSEZNDZDKBN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 195.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.79 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|