C12H26O7S2 — CID 87151518
2-ethyl-1-(2-ethyl-1-sulfobutoxy)butane-1-sulfonic acid (PubChem CID 87151518) has the molecular formula C12H26O7S2 and a molecular weight of 346.47 g/mol. Its IUPAC name is 2-ethyl-1-(2-ethyl-1-sulfobutoxy)butane-1-sulfonic acid.
| Compound Name | 2-ethyl-1-(2-ethyl-1-sulfobutoxy)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 87151518 |
| Molecular Formula | C12H26O7S2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 2-ethyl-1-(2-ethyl-1-sulfobutoxy)butane-1-sulfonic acid |
| SMILES | CCC(CC)C(OC(C(CC)CC)S(=O)(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C12H26O7S2/c1-5-9(6-2)11(20(13,14)15)19-12(21(16,17)18)10(7-3)8-4/h9-12H,5-8H2,1-4H3,(H,13,14,15)(H,16,17,18) |
| InChIKey | NCJPOAMWBDXVKT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|