C10H18O9S2 — CID 87128526
2-[2-(sulfomethyl)butanoyloxycarbonyl]butane-1-sulfonic acid (PubChem CID 87128526) has the molecular formula C10H18O9S2 and a molecular weight of 346.38 g/mol. Its IUPAC name is 2-[2-(sulfomethyl)butanoyloxycarbonyl]butane-1-sulfonic acid.
| Compound Name | 2-[2-(sulfomethyl)butanoyloxycarbonyl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 87128526 |
| Molecular Formula | C10H18O9S2 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 2-[2-(sulfomethyl)butanoyloxycarbonyl]butane-1-sulfonic acid |
| SMILES | CCC(CS(=O)(=O)O)C(=O)OC(=O)C(CC)CS(=O)(=O)O |
| InChI | InChI=1S/C10H18O9S2/c1-3-7(5-20(13,14)15)9(11)19-10(12)8(4-2)6-21(16,17)18/h7-8H,3-6H2,1-2H3,(H,13,14,15)(H,16,17,18) |
| InChIKey | NPZONHXDAXLPSV-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 152.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|