C27H44N2O2S2 — CID 174773379
O-(2-nonylphenyl) 2-amino-2-(5-carbamothioyloxy-1,3,3-trimethylcyclohexyl)ethanethioate (PubChem CID 174773379) has the molecular formula C27H44N2O2S2 and a molecular weight of 492.80 g/mol. Its IUPAC name is O-(2-nonylphenyl) 2-amino-2-(5-carbamothioyloxy-1,3,3-trimethylcyclohexyl)ethanethioate.
| Compound Name | O-(2-nonylphenyl) 2-amino-2-(5-carbamothioyloxy-1,3,3-trimethylcyclohexyl)ethanethioate |
|---|---|
| PubChem CID | 174773379 |
| Molecular Formula | C27H44N2O2S2 |
| Molecular Weight | 492.80 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | O-(2-nonylphenyl) 2-amino-2-(5-carbamothioyloxy-1,3,3-trimethylcyclohexyl)ethanethioate |
| SMILES | CCCCCCCCCc1ccccc1OC(=S)C(N)C1(C)CC(OC(N)=S)CC(C)(C)C1 |
| InChI | InChI=1S/C27H44N2O2S2/c1-5-6-7-8-9-10-11-14-20-15-12-13-16-22(20)31-24(32)23(28)27(4)18-21(30-25(29)33)17-26(2,3)19-27/h12-13,15-16,21,23H,5-11,14,17-19,28H2,1-4H3,(H2,29,33) |
| InChIKey | GOVOFAYQTOKTOR-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.80 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|