C14H20FNO3 — CID 174774354
[(3S)-3-(2-fluorophenyl)-5-methoxy-2-methylpentan-2-yl] carbamate (PubChem CID 174774354) has the molecular formula C14H20FNO3 and a molecular weight of 269.32 g/mol. Its IUPAC name is [(3S)-3-(2-fluorophenyl)-5-methoxy-2-methylpentan-2-yl] carbamate.
| Compound Name | [(3S)-3-(2-fluorophenyl)-5-methoxy-2-methylpentan-2-yl] carbamate |
|---|---|
| PubChem CID | 174774354 |
| Molecular Formula | C14H20FNO3 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | [(3S)-3-(2-fluorophenyl)-5-methoxy-2-methylpentan-2-yl] carbamate |
| SMILES | COCC[C@@H](c1ccccc1F)C(C)(C)OC(N)=O |
| InChI | InChI=1S/C14H20FNO3/c1-14(2,19-13(16)17)11(8-9-18-3)10-6-4-5-7-12(10)15/h4-7,11H,8-9H2,1-3H3,(H2,16,17)/t11-/m0/s1 |
| InChIKey | NRLSVRUBGXHZDR-NSHDSACASA-N |
| XLogP | 2.82 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |