About [3-amino-3-(2-fluorophenyl)propyl] carbamate;methane
[3-amino-3-(2-fluorophenyl)propyl] carbamate;methane (PubChem CID 158668291) has the molecular formula C11H17FN2O2
and a molecular weight of 228.27 g/mol. Its IUPAC name is [3-amino-3-(2-fluorophenyl)propyl] carbamate;methane.
Molecular Properties
| Compound Name | [3-amino-3-(2-fluorophenyl)propyl] carbamate;methane |
| PubChem CID | 158668291 |
| Molecular Formula | C11H17FN2O2 |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | [3-amino-3-(2-fluorophenyl)propyl] carbamate;methane |
| SMILES | C.NC(=O)OCCC(N)c1ccccc1F |
| InChI | InChI=1S/C10H13FN2O2.CH4/c11-8-4-2-1-3-7(8)9(12)5-6-15-10(13)14;/h1-4,9H,5-6,12H2,(H2,13,14);1H4 |
| InChIKey | IDQCBIAJEXEQRH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-amino-3-(2-fluorophenyl)propyl] carbamate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-amino-3-(2-fluorophenyl)propyl] carbamate;methane?
The IUPAC name of [3-amino-3-(2-fluorophenyl)propyl] carbamate;methane (CID 158668291) is [3-amino-3-(2-fluorophenyl)propyl] carbamate;methane.
What is the SMILES notation for [3-amino-3-(2-fluorophenyl)propyl] carbamate;methane?
The canonical SMILES for [3-amino-3-(2-fluorophenyl)propyl] carbamate;methane is C.NC(=O)OCCC(N)c1ccccc1F.
What is the InChIKey of [3-amino-3-(2-fluorophenyl)propyl] carbamate;methane?
The InChIKey is IDQCBIAJEXEQRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13FN2O2.CH4/c11-8-4-2-1-3-7(8)9(12)5-6-15-10(13)14;/h1-4,9H,5-6,12H2,(H2,13,14);1H4.
What are the key properties of [3-amino-3-(2-fluorophenyl)propyl] carbamate;methane?
[3-amino-3-(2-fluorophenyl)propyl] carbamate;methane has a molecular weight of 228.27 g/mol, XLogP of 1.95, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-amino-3-(2-fluorophenyl)propyl] carbamate;methane is sourced from PubChem (CID 158668291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).