azidooxyphosphonamidic acid

H3N4O3P — CID 174774857

IUPACazidooxyphosphonamidic acid
SMILES[N-]=[N+]=NOP(N)(=O)O
InChIInChI=1S/H3N4O3P/c1-3-4-7-8(2,5)6/h(H3,2,5,6)
InChIKeyGQFNWVZSKUGWKJ-UHFFFAOYSA-N
MW138.02 g/mol
LogP0.29
Rot. Bonds2

About azidooxyphosphonamidic acid

azidooxyphosphonamidic acid (PubChem CID 174774857) has the molecular formula H3N4O3P and a molecular weight of 138.02 g/mol. Its IUPAC name is azidooxyphosphonamidic acid.

Molecular Properties

Compound Nameazidooxyphosphonamidic acid
PubChem CID174774857
Molecular FormulaH3N4O3P
Molecular Weight138.02 g/mol
Exact Mass137.99
IUPAC Nameazidooxyphosphonamidic acid
SMILES[N-]=[N+]=NOP(N)(=O)O
InChIInChI=1S/H3N4O3P/c1-3-4-7-8(2,5)6/h(H3,2,5,6)
InChIKeyGQFNWVZSKUGWKJ-UHFFFAOYSA-N
XLogP0.29
TPSA121.31 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500138.02
LogP ≤ 50.29
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze azidooxyphosphonamidic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of azidooxyphosphonamidic acid?
The IUPAC name of azidooxyphosphonamidic acid (CID 174774857) is azidooxyphosphonamidic acid.
What is the SMILES notation for azidooxyphosphonamidic acid?
The canonical SMILES for azidooxyphosphonamidic acid is [N-]=[N+]=NOP(N)(=O)O.
What is the InChIKey of azidooxyphosphonamidic acid?
The InChIKey is GQFNWVZSKUGWKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/H3N4O3P/c1-3-4-7-8(2,5)6/h(H3,2,5,6).
What are the key properties of azidooxyphosphonamidic acid?
azidooxyphosphonamidic acid has a molecular weight of 138.02 g/mol, XLogP of 0.29, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azidooxyphosphonamidic acid is sourced from PubChem (CID 174774857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).