About CID 159901352
CID 159901352 (PubChem CID 159901352) has the molecular formula H6N12O2P2
and a molecular weight of 268.08 g/mol.
Molecular Properties
| Compound Name | CID 159901352 |
| PubChem CID | 159901352 |
| Molecular Formula | H6N12O2P2 |
| Molecular Weight | 268.08 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | — |
| SMILES | NP(N)(N)=O.[N-]=[N+]=NP(=O)(N=[N+]=[N-])N=[N+]=[N-] |
| InChI | InChI=1S/N9OP.H6N3OP/c1-4-7-11(10,8-5-2)9-6-3;1-5(2,3)4/h;(H6,1,2,3,4) |
| InChIKey | NVZOUQKLWDOGTI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 258.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.08 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze CID 159901352 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159901352?
The IUPAC name of CID 159901352 (CID 159901352) is not available.
What is the SMILES notation for CID 159901352?
The canonical SMILES for CID 159901352 is NP(N)(N)=O.[N-]=[N+]=NP(=O)(N=[N+]=[N-])N=[N+]=[N-].
What is the InChIKey of CID 159901352?
The InChIKey is NVZOUQKLWDOGTI-UHFFFAOYSA-N. The full InChI is InChI=1S/N9OP.H6N3OP/c1-4-7-11(10,8-5-2)9-6-3;1-5(2,3)4/h;(H6,1,2,3,4).
What are the key properties of CID 159901352?
CID 159901352 has a molecular weight of 268.08 g/mol, XLogP of 2.00, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159901352 is sourced from PubChem (CID 159901352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).