About diazanium;N-(3-azido-3-phosphonatopropyl)-N-hydroxyacetamide
diazanium;N-(3-azido-3-phosphonatopropyl)-N-hydroxyacetamide (PubChem CID 71522022) has the molecular formula C5H17N6O5P
and a molecular weight of 272.20 g/mol. Its IUPAC name is diazanium;N-(3-azido-3-phosphonatopropyl)-N-hydroxyacetamide.
Molecular Properties
| Compound Name | diazanium;N-(3-azido-3-phosphonatopropyl)-N-hydroxyacetamide |
| PubChem CID | 71522022 |
| Molecular Formula | C5H17N6O5P |
| Molecular Weight | 272.20 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | diazanium;N-(3-azido-3-phosphonatopropyl)-N-hydroxyacetamide |
| SMILES | CC(=O)N(O)CCC(N=[N+]=[N-])P(=O)([O-])[O-].[NH4+].[NH4+] |
| InChI | InChI=1S/C5H11N4O5P.2H3N/c1-4(10)9(11)3-2-5(7-8-6)15(12,13)14;;/h5,11H,2-3H2,1H3,(H2,12,13,14);2*1H3 |
| InChIKey | ATSNHPPAMIZWRO-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 225.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.20 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze diazanium;N-(3-azido-3-phosphonatopropyl)-N-hydroxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazanium;N-(3-azido-3-phosphonatopropyl)-N-hydroxyacetamide?
The IUPAC name of diazanium;N-(3-azido-3-phosphonatopropyl)-N-hydroxyacetamide (CID 71522022) is diazanium;N-(3-azido-3-phosphonatopropyl)-N-hydroxyacetamide.
What is the SMILES notation for diazanium;N-(3-azido-3-phosphonatopropyl)-N-hydroxyacetamide?
The canonical SMILES for diazanium;N-(3-azido-3-phosphonatopropyl)-N-hydroxyacetamide is CC(=O)N(O)CCC(N=[N+]=[N-])P(=O)([O-])[O-].[NH4+].[NH4+].
What is the InChIKey of diazanium;N-(3-azido-3-phosphonatopropyl)-N-hydroxyacetamide?
The InChIKey is ATSNHPPAMIZWRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N4O5P.2H3N/c1-4(10)9(11)3-2-5(7-8-6)15(12,13)14;;/h5,11H,2-3H2,1H3,(H2,12,13,14);2*1H3.
What are the key properties of diazanium;N-(3-azido-3-phosphonatopropyl)-N-hydroxyacetamide?
diazanium;N-(3-azido-3-phosphonatopropyl)-N-hydroxyacetamide has a molecular weight of 272.20 g/mol, XLogP of -0.08, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diazanium;N-(3-azido-3-phosphonatopropyl)-N-hydroxyacetamide is sourced from PubChem (CID 71522022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).