C6H15N4O5P — CID 71816115
[3-[acetyl(hydroxy)amino]-1-(diaminomethylideneamino)propyl]phosphonic acid (PubChem CID 71816115) has the molecular formula C6H15N4O5P and a molecular weight of 254.18 g/mol. Its IUPAC name is [3-[acetyl(hydroxy)amino]-1-(diaminomethylideneamino)propyl]phosphonic acid.
| Compound Name | [3-[acetyl(hydroxy)amino]-1-(diaminomethylideneamino)propyl]phosphonic acid |
|---|---|
| PubChem CID | 71816115 |
| Molecular Formula | C6H15N4O5P |
| Molecular Weight | 254.18 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | [3-[acetyl(hydroxy)amino]-1-(diaminomethylideneamino)propyl]phosphonic acid |
| SMILES | CC(=O)N(O)CCC(N=C(N)N)P(=O)(O)O |
| InChI | InChI=1S/C6H15N4O5P/c1-4(11)10(12)3-2-5(9-6(7)8)16(13,14)15/h5,12H,2-3H2,1H3,(H4,7,8,9)(H2,13,14,15) |
| InChIKey | BLYJTCWDYBRVBJ-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 162.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.18 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|